C26H31N3O5 — CID 177200827
tert-butyl N-[1-cyano-2-[4-[2-oxo-3-(2-propoxyethyl)-1,3-benzoxazol-5-yl]phenyl]ethyl]carbamate (PubChem CID 177200827) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is tert-butyl N-[1-cyano-2-[4-[2-oxo-3-(2-propoxyethyl)-1,3-benzoxazol-5-yl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyano-2-[4-[2-oxo-3-(2-propoxyethyl)-1,3-benzoxazol-5-yl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 177200827 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | tert-butyl N-[1-cyano-2-[4-[2-oxo-3-(2-propoxyethyl)-1,3-benzoxazol-5-yl]phenyl]ethyl]carbamate |
| SMILES | CCCOCCn1c(=O)oc2ccc(-c3ccc(CC(C#N)NC(=O)OC(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C26H31N3O5/c1-5-13-32-14-12-29-22-16-20(10-11-23(22)33-25(29)31)19-8-6-18(7-9-19)15-21(17-27)28-24(30)34-26(2,3)4/h6-11,16,21H,5,12-15H2,1-4H3,(H,28,30) |
| InChIKey | OUDDWCIYEDCAIC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|