About CID 177201211
CID 177201211 (PubChem CID 177201211) has the molecular formula C30H19B2ClF7N5O
and a molecular weight of 655.58 g/mol.
Molecular Properties
| Compound Name | CID 177201211 |
| PubChem CID | 177201211 |
| Molecular Formula | C30H19B2ClF7N5O |
| Molecular Weight | 655.58 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N1C(=C)N(CC(F)(F)F)c2cc(Nc3nccc4c(C(F)(F)F)cccc34)c3c(c21)C(=C)NC3c1cc(F)ccc1Cl |
| InChI | InChI=1S/C30H19B2ClF7N5O/c1-13-23-24(25(42-13)18-10-15(34)6-7-20(18)33)21(43-27-17-4-3-5-19(29(38,39)40)16(17)8-9-41-27)11-22-26(23)45(30(31,32)46)14(2)44(22)12-28(35,36)37/h3-11,25,42,46H,1-2,12H2,(H,41,43) |
| InChIKey | NJJNPILYIQVJIT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177201211 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177201211?
The IUPAC name of CID 177201211 (CID 177201211) is not available.
What is the SMILES notation for CID 177201211?
The canonical SMILES for CID 177201211 is [B]C([B])(O)N1C(=C)N(CC(F)(F)F)c2cc(Nc3nccc4c(C(F)(F)F)cccc34)c3c(c21)C(=C)NC3c1cc(F)ccc1Cl.
What is the InChIKey of CID 177201211?
The InChIKey is NJJNPILYIQVJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H19B2ClF7N5O/c1-13-23-24(25(42-13)18-10-15(34)6-7-20(18)33)21(43-27-17-4-3-5-19(29(38,39)40)16(17)8-9-41-27)11-22-26(23)45(30(31,32)46)14(2)44(22)12-28(35,36)37/h3-11,25,42,46H,1-2,12H2,(H,41,43).
What are the key properties of CID 177201211?
CID 177201211 has a molecular weight of 655.58 g/mol, XLogP of 7.05, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177201211 is sourced from PubChem (CID 177201211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).