About (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine
(3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine (PubChem CID 177202388) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine |
| PubChem CID | 177202388 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine |
| SMILES | C=c1c(F)cc(N)c/c1=C/C |
| InChI | InChI=1S/C9H10FN/c1-3-7-4-8(11)5-9(10)6(7)2/h3-5H,2,11H2,1H3/b7-3- |
| InChIKey | QJJIBTFQMHQQOL-CLTKARDFSA-N |
| XLogP | 0.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine?
The IUPAC name of (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine (CID 177202388) is (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine.
What is the SMILES notation for (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine?
The canonical SMILES for (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine is C=c1c(F)cc(N)c/c1=C/C.
What is the InChIKey of (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine?
The InChIKey is QJJIBTFQMHQQOL-CLTKARDFSA-N. The full InChI is InChI=1S/C9H10FN/c1-3-7-4-8(11)5-9(10)6(7)2/h3-5H,2,11H2,1H3/b7-3-.
What are the key properties of (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine?
(3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine has a molecular weight of 151.18 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethylidene-5-fluoro-4-methylidenecyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 177202388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).