C9H8ClNO2S — CID 177202395
6-chlorothieno[2,3-b]pyridine-2-carbaldehyde;methanol (PubChem CID 177202395) has the molecular formula C9H8ClNO2S and a molecular weight of 229.69 g/mol. Its IUPAC name is 6-chlorothieno[2,3-b]pyridine-2-carbaldehyde;methanol.
| Compound Name | 6-chlorothieno[2,3-b]pyridine-2-carbaldehyde;methanol |
|---|---|
| PubChem CID | 177202395 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 6-chlorothieno[2,3-b]pyridine-2-carbaldehyde;methanol |
| SMILES | CO.O=Cc1cc2ccc(Cl)nc2s1 |
| InChI | InChI=1S/C8H4ClNOS.CH4O/c9-7-2-1-5-3-6(4-11)12-8(5)10-7;1-2/h1-4H;2H,1H3 |
| InChIKey | IOWCHQAYSYTWCJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|