C17H21N3OS — CID 177202410
1-[6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)amino]thieno[2,3-b]pyridin-2-yl]ethanone (PubChem CID 177202410) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)amino]thieno[2,3-b]pyridin-2-yl]ethanone.
| Compound Name | 1-[6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)amino]thieno[2,3-b]pyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 177202410 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[6-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl)amino]thieno[2,3-b]pyridin-2-yl]ethanone |
| SMILES | CC(=O)c1cc2ccc(NC3CCC4CN(C)CC43)nc2s1 |
| InChI | InChI=1S/C17H21N3OS/c1-10(21)15-7-11-4-6-16(19-17(11)22-15)18-14-5-3-12-8-20(2)9-13(12)14/h4,6-7,12-14H,3,5,8-9H2,1-2H3,(H,18,19) |
| InChIKey | QACLOMZBAOCGGK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |