C15H9ClFN5OS — CID 177202450
5-chloro-N-(7-fluoro-2-methylindazol-5-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carboxamide (PubChem CID 177202450) has the molecular formula C15H9ClFN5OS and a molecular weight of 361.79 g/mol. Its IUPAC name is 5-chloro-N-(7-fluoro-2-methylindazol-5-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-(7-fluoro-2-methylindazol-5-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177202450 |
| Molecular Formula | C15H9ClFN5OS |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 5-chloro-N-(7-fluoro-2-methylindazol-5-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carboxamide |
| SMILES | Cn1cc2cc(NC(=O)c3nc4ccc(Cl)nc4s3)cc(F)c2n1 |
| InChI | InChI=1S/C15H9ClFN5OS/c1-22-6-7-4-8(5-9(17)12(7)21-22)18-13(23)15-19-10-2-3-11(16)20-14(10)24-15/h2-6H,1H3,(H,18,23) |
| InChIKey | NLPYVHSYJVPGJG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|