About 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine
5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine (PubChem CID 177202538) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine.
Molecular Properties
| Compound Name | 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine |
| PubChem CID | 177202538 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine |
| SMILES | CCN1CC(N(C)C)C2(CC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-4-12-7-9(11(2)3)10(8-12)5-6-10/h9H,4-8H2,1-3H3 |
| InChIKey | QPKKSLHNJCWBNW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
The IUPAC name of 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine (CID 177202538) is 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine.
What is the SMILES notation for 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
The canonical SMILES for 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine is CCN1CC(N(C)C)C2(CC2)C1.
What is the InChIKey of 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
The InChIKey is QPKKSLHNJCWBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-4-12-7-9(11(2)3)10(8-12)5-6-10/h9H,4-8H2,1-3H3.
What are the key properties of 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine has a molecular weight of 168.28 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine is sourced from PubChem (CID 177202538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).