C14H19N5OS — CID 177202560
5-(1,7-diazaspiro[3.4]octan-7-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde;methanamine (PubChem CID 177202560) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 5-(1,7-diazaspiro[3.4]octan-7-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde;methanamine.
| Compound Name | 5-(1,7-diazaspiro[3.4]octan-7-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 177202560 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-(1,7-diazaspiro[3.4]octan-7-yl)-[1,3]thiazolo[5,4-b]pyridine-2-carbaldehyde;methanamine |
| SMILES | CN.O=Cc1nc2ccc(N3CCC4(CCN4)C3)nc2s1 |
| InChI | InChI=1S/C13H14N4OS.CH5N/c18-7-11-15-9-1-2-10(16-12(9)19-11)17-6-4-13(8-17)3-5-14-13;1-2/h1-2,7,14H,3-6,8H2;2H2,1H3 |
| InChIKey | OODQNLUIXRNCCV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|