About 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide
4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide (PubChem CID 177202748) has the molecular formula C10H21IN3O-
and a molecular weight of 326.20 g/mol. Its IUPAC name is 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide |
| PubChem CID | 177202748 |
| Molecular Formula | C10H21IN3O- |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide |
| SMILES | CC[I-]N1CCN(C(=O)N(C)C)C(C)C1 |
| InChI | InChI=1S/C10H21IN3O/c1-5-11-13-6-7-14(9(2)8-13)10(15)12(3)4/h9H,5-8H2,1-4H3/q-1 |
| InChIKey | AUMIQDNDZJXXMW-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide?
The IUPAC name of 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide (CID 177202748) is 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide.
What is the SMILES notation for 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide?
The canonical SMILES for 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide is CC[I-]N1CCN(C(=O)N(C)C)C(C)C1.
What is the InChIKey of 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide?
The InChIKey is AUMIQDNDZJXXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21IN3O/c1-5-11-13-6-7-14(9(2)8-13)10(15)12(3)4/h9H,5-8H2,1-4H3/q-1.
What are the key properties of 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide?
4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide has a molecular weight of 326.20 g/mol, XLogP of -2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyliodanuidyl-N,N,2-trimethylpiperazine-1-carboxamide is sourced from PubChem (CID 177202748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).