About piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol
piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol (PubChem CID 177205207) has the molecular formula C12H17F3N2O
and a molecular weight of 262.27 g/mol. Its IUPAC name is piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol |
| PubChem CID | 177205207 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol |
| SMILES | C1CCNCC1.OCc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H6F3NO.C5H11N/c8-7(9,10)6-3-1-2-5(4-12)11-6;1-2-4-6-5-3-1/h1-3,12H,4H2;6H,1-5H2 |
| InChIKey | BOKDMGGYVSGAHM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol?
The IUPAC name of piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol (CID 177205207) is piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol.
What is the SMILES notation for piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol?
The canonical SMILES for piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol is C1CCNCC1.OCc1cccc(C(F)(F)F)n1.
What is the InChIKey of piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol?
The InChIKey is BOKDMGGYVSGAHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO.C5H11N/c8-7(9,10)6-3-1-2-5(4-12)11-6;1-2-4-6-5-3-1/h1-3,12H,4H2;6H,1-5H2.
What are the key properties of piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol?
piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol has a molecular weight of 262.27 g/mol, XLogP of 2.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;[6-(trifluoromethyl)-2-pyridinyl]methanol is sourced from PubChem (CID 177205207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).