About (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one
(2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 177205270) has the molecular formula C12H17F3N2O
and a molecular weight of 262.27 g/mol. Its IUPAC name is (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one |
| PubChem CID | 177205270 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | C[C@@H]1CCCCN1.O=c1cccc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C6H4F3NO.C6H13N/c7-6(8,9)4-2-1-3-5(11)10-4;1-6-4-2-3-5-7-6/h1-3H,(H,10,11);6-7H,2-5H2,1H3/t;6-/m.1/s1 |
| InChIKey | AUWXVOXSFZSOOI-FCXZQVPUSA-N |
| XLogP | 2.54 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one?
The IUPAC name of (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one (CID 177205270) is (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one.
What is the SMILES notation for (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one?
The canonical SMILES for (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one is C[C@@H]1CCCCN1.O=c1cccc(C(F)(F)F)[nH]1.
What is the InChIKey of (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one?
The InChIKey is AUWXVOXSFZSOOI-FCXZQVPUSA-N. The full InChI is InChI=1S/C6H4F3NO.C6H13N/c7-6(8,9)4-2-1-3-5(11)10-4;1-6-4-2-3-5-7-6/h1-3H,(H,10,11);6-7H,2-5H2,1H3/t;6-/m.1/s1.
What are the key properties of (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one?
(2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one has a molecular weight of 262.27 g/mol, XLogP of 2.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylpiperidine;6-(trifluoromethyl)-1H-pyridin-2-one is sourced from PubChem (CID 177205270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).