C22H24F3N5O3 — CID 177205368
(4-amino-1,3,6,7,8,9-hexahydrofuro[3,4-c][1,7]naphthyridin-8-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone;6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 177205368) has the molecular formula C22H24F3N5O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is (4-amino-1,3,6,7,8,9-hexahydrofuro[3,4-c][1,7]naphthyridin-8-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone;6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | (4-amino-1,3,6,7,8,9-hexahydrofuro[3,4-c][1,7]naphthyridin-8-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone;6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 177205368 |
| Molecular Formula | C22H24F3N5O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (4-amino-1,3,6,7,8,9-hexahydrofuro[3,4-c][1,7]naphthyridin-8-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone;6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Nc1nc2c(c3c1COC3)CC(C(=O)N1CC=CCC1)NC2.O=c1cccc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C16H20N4O2.C6H4F3NO/c17-15-12-9-22-8-11(12)10-6-13(18-7-14(10)19-15)16(21)20-4-2-1-3-5-20;7-6(8,9)4-2-1-3-5(11)10-4/h1-2,13,18H,3-9H2,(H2,17,19);1-3H,(H,10,11) |
| InChIKey | PKQCNXVUYBFUFM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|