About 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol
2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol (PubChem CID 177205528) has the molecular formula C12H20ClNO2
and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol.
Molecular Properties
| Compound Name | 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol |
| PubChem CID | 177205528 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol |
| SMILES | C.CCCO.Clc1ccc2c(n1)COCC2 |
| InChI | InChI=1S/C8H8ClNO.C3H8O.CH4/c9-8-2-1-6-3-4-11-5-7(6)10-8;1-2-3-4;/h1-2H,3-5H2;4H,2-3H2,1H3;1H4 |
| InChIKey | CFQHJFDIRPHFTB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol?
The IUPAC name of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol (CID 177205528) is 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol.
What is the SMILES notation for 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol?
The canonical SMILES for 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol is C.CCCO.Clc1ccc2c(n1)COCC2.
What is the InChIKey of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol?
The InChIKey is CFQHJFDIRPHFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO.C3H8O.CH4/c9-8-2-1-6-3-4-11-5-7(6)10-8;1-2-3-4;/h1-2H,3-5H2;4H,2-3H2,1H3;1H4.
What are the key properties of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol?
2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol has a molecular weight of 245.75 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine;methane;propan-1-ol is sourced from PubChem (CID 177205528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).