C13H15F2NO3 — CID 177205533
(2R,4aS,10bS)-8-(difluoromethoxy)-2-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b][1,4]oxazine (PubChem CID 177205533) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is (2R,4aS,10bS)-8-(difluoromethoxy)-2-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b][1,4]oxazine.
| Compound Name | (2R,4aS,10bS)-8-(difluoromethoxy)-2-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 177205533 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R,4aS,10bS)-8-(difluoromethoxy)-2-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b][1,4]oxazine |
| SMILES | C[C@@H]1CO[C@@H]2COc3cc(OC(F)F)ccc3[C@@H]2N1 |
| InChI | InChI=1S/C13H15F2NO3/c1-7-5-17-11-6-18-10-4-8(19-13(14)15)2-3-9(10)12(11)16-7/h2-4,7,11-13,16H,5-6H2,1H3/t7-,11-,12+/m1/s1 |
| InChIKey | XYSDSQHKNUNSLR-HFKOZYHYSA-N |
| XLogP | 2.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |