C25H29F2N3O3 — CID 177205608
(6R)-6-[4-(difluoromethoxy)-2-methylphenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;1,3,6,7,8,9-hexahydrofuro[3,4-c]quinolin-4-amine (PubChem CID 177205608) has the molecular formula C25H29F2N3O3 and a molecular weight of 457.52 g/mol. Its IUPAC name is (6R)-6-[4-(difluoromethoxy)-2-methylphenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;1,3,6,7,8,9-hexahydrofuro[3,4-c]quinolin-4-amine.
| Compound Name | (6R)-6-[4-(difluoromethoxy)-2-methylphenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;1,3,6,7,8,9-hexahydrofuro[3,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 177205608 |
| Molecular Formula | C25H29F2N3O3 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (6R)-6-[4-(difluoromethoxy)-2-methylphenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;1,3,6,7,8,9-hexahydrofuro[3,4-c]quinolin-4-amine |
| SMILES | Cc1cc(OC(F)F)ccc1[C@H]1C=CCCN1C=O.Nc1nc2c(c3c1COC3)CCCC2 |
| InChI | InChI=1S/C14H15F2NO2.C11H14N2O/c1-10-8-11(19-14(15)16)5-6-12(10)13-4-2-3-7-17(13)9-18;12-11-9-6-14-5-8(9)7-3-1-2-4-10(7)13-11/h2,4-6,8-9,13-14H,3,7H2,1H3;1-6H2,(H2,12,13)/t13-;/m1./s1 |
| InChIKey | QPSORPDMLGQRLO-BTQNPOSSSA-N |
| XLogP | 4.63 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|