C13H15F3N2O — CID 177205664
(2S,7S,9S)-9-methyl-12-(trifluoromethyl)-8-oxa-3,11-diazatricyclo[8.4.0.02,7]tetradeca-1(10),11,13-triene (PubChem CID 177205664) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is (2S,7S,9S)-9-methyl-12-(trifluoromethyl)-8-oxa-3,11-diazatricyclo[8.4.0.02,7]tetradeca-1(10),11,13-triene.
| Compound Name | (2S,7S,9S)-9-methyl-12-(trifluoromethyl)-8-oxa-3,11-diazatricyclo[8.4.0.02,7]tetradeca-1(10),11,13-triene |
|---|---|
| PubChem CID | 177205664 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (2S,7S,9S)-9-methyl-12-(trifluoromethyl)-8-oxa-3,11-diazatricyclo[8.4.0.02,7]tetradeca-1(10),11,13-triene |
| SMILES | C[C@@H]1O[C@H]2CCCN[C@H]2c2ccc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C13H15F3N2O/c1-7-11-8(4-5-10(18-11)13(14,15)16)12-9(19-7)3-2-6-17-12/h4-5,7,9,12,17H,2-3,6H2,1H3/t7-,9-,12-/m0/s1 |
| InChIKey | FKSJNYJYBDPHCW-DXBFQKDVSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |