C10H10BrClO — CID 177205675
(1R,2S)-2-bromo-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 177205675) has the molecular formula C10H10BrClO and a molecular weight of 261.55 g/mol. Its IUPAC name is (1R,2S)-2-bromo-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2S)-2-bromo-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 177205675 |
| Molecular Formula | C10H10BrClO |
| Molecular Weight | 261.55 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | (1R,2S)-2-bromo-6-chloro-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@@H]1c2ccc(Cl)cc2CC[C@@H]1Br |
| InChI | InChI=1S/C10H10BrClO/c11-9-4-1-6-5-7(12)2-3-8(6)10(9)13/h2-3,5,9-10,13H,1,4H2/t9-,10+/m0/s1 |
| InChIKey | CRNLHYAGKDHSJR-VHSXEESVSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|