About (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine
(6-cyclopropyloxy-2-pyridinyl)methanol;piperidine (PubChem CID 177205678) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine.
Molecular Properties
| Compound Name | (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine |
| PubChem CID | 177205678 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine |
| SMILES | C1CCNCC1.OCc1cccc(OC2CC2)n1 |
| InChI | InChI=1S/C9H11NO2.C5H11N/c11-6-7-2-1-3-9(10-7)12-8-4-5-8;1-2-4-6-5-3-1/h1-3,8,11H,4-6H2;6H,1-5H2 |
| InChIKey | IVAQMZATCMXPNK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine?
The IUPAC name of (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine (CID 177205678) is (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine.
What is the SMILES notation for (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine?
The canonical SMILES for (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine is C1CCNCC1.OCc1cccc(OC2CC2)n1.
What is the InChIKey of (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine?
The InChIKey is IVAQMZATCMXPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C5H11N/c11-6-7-2-1-3-9(10-7)12-8-4-5-8;1-2-4-6-5-3-1/h1-3,8,11H,4-6H2;6H,1-5H2.
What are the key properties of (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine?
(6-cyclopropyloxy-2-pyridinyl)methanol;piperidine has a molecular weight of 250.34 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyclopropyloxy-2-pyridinyl)methanol;piperidine is sourced from PubChem (CID 177205678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).