C50H101NO — CID 177206564
1-(1-butyl-5-propylpyrrolidin-2-yl)-2-methylheptan-4-one;4-ethyl-7-methyldec-1-ene;octadecane (PubChem CID 177206564) has the molecular formula C50H101NO and a molecular weight of 732.36 g/mol. Its IUPAC name is 1-(1-butyl-5-propylpyrrolidin-2-yl)-2-methylheptan-4-one;4-ethyl-7-methyldec-1-ene;octadecane.
| Compound Name | 1-(1-butyl-5-propylpyrrolidin-2-yl)-2-methylheptan-4-one;4-ethyl-7-methyldec-1-ene;octadecane |
|---|---|
| PubChem CID | 177206564 |
| Molecular Formula | C50H101NO |
| Molecular Weight | 732.36 g/mol |
| Exact Mass | 731.79 |
| IUPAC Name | 1-(1-butyl-5-propylpyrrolidin-2-yl)-2-methylheptan-4-one;4-ethyl-7-methyldec-1-ene;octadecane |
| SMILES | C=CCC(CC)CCC(C)CCC.CCCCCCCCCCCCCCCCCC.CCCCN1C(CCC)CCC1CC(C)CC(=O)CCC |
| InChI | InChI=1S/C19H37NO.C18H38.C13H26/c1-5-8-13-20-17(9-6-2)11-12-18(20)14-16(4)15-19(21)10-7-3;1-3-5-7-9-11-13-15-17-18-16-14-12-10-8-6-4-2;1-5-8-12(4)10-11-13(7-3)9-6-2/h16-18H,5-15H2,1-4H3;3-18H2,1-2H3;6,12-13H,2,5,7-11H2,1,3-4H3 |
| InChIKey | RUNRBFRCZZEPBC-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.36 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|