About 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine
2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine (PubChem CID 177207182) has the molecular formula C13H19F4NO2S
and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine |
| PubChem CID | 177207182 |
| Molecular Formula | C13H19F4NO2S |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine |
| SMILES | CC(F)CO.CSC.FC(F)(F)c1ccc2c(n1)OCC2 |
| InChI | InChI=1S/C8H6F3NO.C3H7FO.C2H6S/c9-8(10,11)6-2-1-5-3-4-13-7(5)12-6;1-3(4)2-5;1-3-2/h1-2H,3-4H2;3,5H,2H2,1H3;1-2H3 |
| InChIKey | TXWZMEXIIXTZOZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine?
The IUPAC name of 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine (CID 177207182) is 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine.
What is the SMILES notation for 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine?
The canonical SMILES for 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine is CC(F)CO.CSC.FC(F)(F)c1ccc2c(n1)OCC2.
What is the InChIKey of 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine?
The InChIKey is TXWZMEXIIXTZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO.C3H7FO.C2H6S/c9-8(10,11)6-2-1-5-3-4-13-7(5)12-6;1-3(4)2-5;1-3-2/h1-2H,3-4H2;3,5H,2H2,1H3;1-2H3.
What are the key properties of 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine?
2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine has a molecular weight of 329.36 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropropan-1-ol;methylsulfanylmethane;6-(trifluoromethyl)-2,3-dihydrofuro[2,3-b]pyridine is sourced from PubChem (CID 177207182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).