About (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene
(3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene (PubChem CID 177207308) has the molecular formula C15H20F2O3
and a molecular weight of 286.32 g/mol. Its IUPAC name is (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene |
| PubChem CID | 177207308 |
| Molecular Formula | C15H20F2O3 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene |
| SMILES | CC(C)CO[C@@H]1COc2cc(OC(F)F)ccc2[C@@H]1C |
| InChI | InChI=1S/C15H20F2O3/c1-9(2)7-18-14-8-19-13-6-11(20-15(16)17)4-5-12(13)10(14)3/h4-6,9-10,14-15H,7-8H2,1-3H3/t10-,14+/m0/s1 |
| InChIKey | GRPFRXNUXXMZKF-IINYFYTJSA-N |
| XLogP | 3.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene?
The IUPAC name of (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene (CID 177207308) is (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene.
What is the SMILES notation for (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene?
The canonical SMILES for (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene is CC(C)CO[C@@H]1COc2cc(OC(F)F)ccc2[C@@H]1C.
What is the InChIKey of (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene?
The InChIKey is GRPFRXNUXXMZKF-IINYFYTJSA-N. The full InChI is InChI=1S/C15H20F2O3/c1-9(2)7-18-14-8-19-13-6-11(20-15(16)17)4-5-12(13)10(14)3/h4-6,9-10,14-15H,7-8H2,1-3H3/t10-,14+/m0/s1.
What are the key properties of (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene?
(3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene has a molecular weight of 286.32 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-7-(difluoromethoxy)-4-methyl-3-(2-methylpropoxy)-3,4-dihydro-2H-chromene is sourced from PubChem (CID 177207308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).