C14H20ClNO — CID 177207320
(5R,6S)-2-chloro-5-methyl-6-(2-methylpropoxy)-5,6,7,8-tetrahydroquinoline (PubChem CID 177207320) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is (5R,6S)-2-chloro-5-methyl-6-(2-methylpropoxy)-5,6,7,8-tetrahydroquinoline.
| Compound Name | (5R,6S)-2-chloro-5-methyl-6-(2-methylpropoxy)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 177207320 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (5R,6S)-2-chloro-5-methyl-6-(2-methylpropoxy)-5,6,7,8-tetrahydroquinoline |
| SMILES | CC(C)CO[C@H]1CCc2nc(Cl)ccc2[C@H]1C |
| InChI | InChI=1S/C14H20ClNO/c1-9(2)8-17-13-6-5-12-11(10(13)3)4-7-14(15)16-12/h4,7,9-10,13H,5-6,8H2,1-3H3/t10-,13+/m1/s1 |
| InChIKey | BFQPIZWJORJFCN-MFKMUULPSA-N |
| XLogP | 3.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|