C17H13F3N2O3 — CID 177207537
ethyl 4-[5-(furan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzoate (PubChem CID 177207537) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is ethyl 4-[5-(furan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[5-(furan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 177207537 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | ethyl 4-[5-(furan-2-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccco2)cc1 |
| InChI | InChI=1S/C17H13F3N2O3/c1-2-24-16(23)11-5-7-12(8-6-11)22-13(14-4-3-9-25-14)10-15(21-22)17(18,19)20/h3-10H,2H2,1H3 |
| InChIKey | LRJGGBVBLSPMPC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |