About ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide
ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide (PubChem CID 177207586) has the molecular formula C13H21F3N2OS
and a molecular weight of 310.39 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide.
Molecular Properties
| Compound Name | ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide |
| PubChem CID | 177207586 |
| Molecular Formula | C13H21F3N2OS |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide |
| SMILES | CC.CC.CSc1ccc(NNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3N2OS.2C2H6/c1-16-7-4-2-6(3-5-7)13-14-8(15)9(10,11)12;2*1-2/h2-5,13H,1H3,(H,14,15);2*1-2H3 |
| InChIKey | FWLOGJUNUQJWPR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide?
The IUPAC name of ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide (CID 177207586) is ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide.
What is the SMILES notation for ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide?
The canonical SMILES for ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide is CC.CC.CSc1ccc(NNC(=O)C(F)(F)F)cc1.
What is the InChIKey of ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide?
The InChIKey is FWLOGJUNUQJWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2OS.2C2H6/c1-16-7-4-2-6(3-5-7)13-14-8(15)9(10,11)12;2*1-2/h2-5,13H,1H3,(H,14,15);2*1-2H3.
What are the key properties of ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide?
ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide has a molecular weight of 310.39 g/mol, XLogP of 4.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,2,2-trifluoro-N'-(4-methylsulfanylphenyl)acetohydrazide is sourced from PubChem (CID 177207586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).