About [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane
[2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane (PubChem CID 177207804) has the molecular formula C16H20BrN3
and a molecular weight of 334.26 g/mol. Its IUPAC name is [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane |
| PubChem CID | 177207804 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane |
| SMILES | CC.NCC1=CN2C=C(c3ccc(Br)cc3)NC2C=C1 |
| InChI | InChI=1S/C14H14BrN3.C2H6/c15-12-4-2-11(3-5-12)13-9-18-8-10(7-16)1-6-14(18)17-13;1-2/h1-6,8-9,14,17H,7,16H2;1-2H3 |
| InChIKey | BCLVBMNSPSEBGA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane?
The IUPAC name of [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane (CID 177207804) is [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane.
What is the SMILES notation for [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane?
The canonical SMILES for [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane is CC.NCC1=CN2C=C(c3ccc(Br)cc3)NC2C=C1.
What is the InChIKey of [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane?
The InChIKey is BCLVBMNSPSEBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3.C2H6/c15-12-4-2-11(3-5-12)13-9-18-8-10(7-16)1-6-14(18)17-13;1-2/h1-6,8-9,14,17H,7,16H2;1-2H3.
What are the key properties of [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane?
[2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane has a molecular weight of 334.26 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-1,8a-dihydroimidazo[1,2-a]pyridin-6-yl]methanamine;ethane is sourced from PubChem (CID 177207804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).