C14H22O2 — CID 177208439
7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane (PubChem CID 177208439) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane.
| Compound Name | 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane |
|---|---|
| PubChem CID | 177208439 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane |
| SMILES | CC.CCCCc1c(O)ccc2c1OCC2 |
| InChI | InChI=1S/C12H16O2.C2H6/c1-2-3-4-10-11(13)6-5-9-7-8-14-12(9)10;1-2/h5-6,13H,2-4,7-8H2,1H3;1-2H3 |
| InChIKey | WQAVJNRTEPCLAJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |