About 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane
7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane (PubChem CID 177208439) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane.
Molecular Properties
| Compound Name | 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane |
| PubChem CID | 177208439 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane |
| SMILES | CC.CCCCc1c(O)ccc2c1OCC2 |
| InChI | InChI=1S/C12H16O2.C2H6/c1-2-3-4-10-11(13)6-5-9-7-8-14-12(9)10;1-2/h5-6,13H,2-4,7-8H2,1H3;1-2H3 |
| InChIKey | WQAVJNRTEPCLAJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane?
The IUPAC name of 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane (CID 177208439) is 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane.
What is the SMILES notation for 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane?
The canonical SMILES for 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane is CC.CCCCc1c(O)ccc2c1OCC2.
What is the InChIKey of 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane?
The InChIKey is WQAVJNRTEPCLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2.C2H6/c1-2-3-4-10-11(13)6-5-9-7-8-14-12(9)10;1-2/h5-6,13H,2-4,7-8H2,1H3;1-2H3.
What are the key properties of 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane?
7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane has a molecular weight of 222.33 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-2,3-dihydro-1-benzofuran-6-ol;ethane is sourced from PubChem (CID 177208439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).