About 6-ethenyl-2,3-dihydrothieno[3,4-b]furan
6-ethenyl-2,3-dihydrothieno[3,4-b]furan (PubChem CID 177208715) has the molecular formula C8H8OS
and a molecular weight of 152.22 g/mol. Its IUPAC name is 6-ethenyl-2,3-dihydrothieno[3,4-b]furan.
Molecular Properties
| Compound Name | 6-ethenyl-2,3-dihydrothieno[3,4-b]furan |
| PubChem CID | 177208715 |
| Molecular Formula | C8H8OS |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 6-ethenyl-2,3-dihydrothieno[3,4-b]furan |
| SMILES | C=Cc1scc2c1OCC2 |
| InChI | InChI=1S/C8H8OS/c1-2-7-8-6(5-10-7)3-4-9-8/h2,5H,1,3-4H2 |
| InChIKey | FIGZHIXAVBEBSZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethenyl-2,3-dihydrothieno[3,4-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,3-dihydrothieno[3,4-b]furan?
The IUPAC name of 6-ethenyl-2,3-dihydrothieno[3,4-b]furan (CID 177208715) is 6-ethenyl-2,3-dihydrothieno[3,4-b]furan.
What is the SMILES notation for 6-ethenyl-2,3-dihydrothieno[3,4-b]furan?
The canonical SMILES for 6-ethenyl-2,3-dihydrothieno[3,4-b]furan is C=Cc1scc2c1OCC2.
What is the InChIKey of 6-ethenyl-2,3-dihydrothieno[3,4-b]furan?
The InChIKey is FIGZHIXAVBEBSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8OS/c1-2-7-8-6(5-10-7)3-4-9-8/h2,5H,1,3-4H2.
What are the key properties of 6-ethenyl-2,3-dihydrothieno[3,4-b]furan?
6-ethenyl-2,3-dihydrothieno[3,4-b]furan has a molecular weight of 152.22 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,3-dihydrothieno[3,4-b]furan is sourced from PubChem (CID 177208715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).