C16H22N4O — CID 177208787
1-(12-ethyl-1,4,7,12-tetrazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-4-yl)ethanone (PubChem CID 177208787) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(12-ethyl-1,4,7,12-tetrazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-4-yl)ethanone.
| Compound Name | 1-(12-ethyl-1,4,7,12-tetrazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-4-yl)ethanone |
|---|---|
| PubChem CID | 177208787 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-(12-ethyl-1,4,7,12-tetrazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-4-yl)ethanone |
| SMILES | CCN1CCC2C(C1)c1cncc3c1N2CCN3C(C)=O |
| InChI | InChI=1S/C16H22N4O/c1-3-18-5-4-14-13(10-18)12-8-17-9-15-16(12)20(14)7-6-19(15)11(2)21/h8-9,13-14H,3-7,10H2,1-2H3 |
| InChIKey | WMGOSGUPSSTYIQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |