C8H7Y3-3 — CID 177209342
1,3-dimethylbenzene-2,4,6-triide;tris(yttrium) (PubChem CID 177209342) has the molecular formula C8H7Y3-3 and a molecular weight of 369.86 g/mol. Its IUPAC name is 1,3-dimethylbenzene-2,4,6-triide;tris(yttrium).
| Compound Name | 1,3-dimethylbenzene-2,4,6-triide;tris(yttrium) |
|---|---|
| PubChem CID | 177209342 |
| Molecular Formula | C8H7Y3-3 |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.77 |
| IUPAC Name | 1,3-dimethylbenzene-2,4,6-triide;tris(yttrium) |
| SMILES | Cc1[c-]c[c-]c(C)[c-]1.[Y].[Y].[Y] |
| InChI | InChI=1S/C8H7.3Y/c1-7-4-3-5-8(2)6-7;;;/h3H,1-2H3;;;/q-3;;; |
| InChIKey | ZUOVLSAFFBWVLB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|