C14H20O5 — CID 177209419
(E)-3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol (PubChem CID 177209419) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (E)-3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 177209419 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (E)-3-[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]prop-2-en-1-ol |
| SMILES | COC1=CC(/C=C/CO)CC(OC)=C1OCC1CO1 |
| InChI | InChI=1S/C14H20O5/c1-16-12-6-10(4-3-5-15)7-13(17-2)14(12)19-9-11-8-18-11/h3-4,6,10-11,15H,5,7-9H2,1-2H3/b4-3+ |
| InChIKey | UPWRVFWZJKWMCZ-ONEGZZNKSA-N |
| XLogP | 1.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|