C33H37AlIN2O13 — CID 177209438
CID 177209438 (PubChem CID 177209438) has the molecular formula C33H37AlIN2O13 and a molecular weight of 823.55 g/mol.
| Compound Name | CID 177209438 |
|---|---|
| PubChem CID | 177209438 |
| Molecular Formula | C33H37AlIN2O13 |
| Molecular Weight | 823.55 g/mol |
| Exact Mass | 823.12 |
| IUPAC Name | — |
| SMILES | [H]/N=C1\c2c(OC)cccc2C(=O)c2c(O)c3c(c(O)c21)C(OC1CC2C(OC4C(OC)OCCN24)C(C)O1)CC(O)(C(O)COC(=O)[Al]I)C3 |
| InChI | InChI=1S/C33H37N2O13.Al.HI/c1-14-30-17(35-7-8-45-32(43-3)31(35)48-30)9-21(46-14)47-19-11-33(41,20(37)12-44-13-36)10-16-23(19)29(40)24-25(28(16)39)27(38)15-5-4-6-18(42-2)22(15)26(24)34;;/h4-6,14,17,19-21,30-32,34,37,39-41H,7-12H2,1-3H3;;1H/q;+1;/p-1/b34-26+;; |
| InChIKey | TUIWIJHEKLRCRW-CZFONNGASA-M |
| XLogP | 1.89 |
| TPSA | 206.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|