About CID 177209576
CID 177209576 (PubChem CID 177209576) has the molecular formula C24H2B13NO
and a molecular weight of 460.84 g/mol.
Molecular Properties
| Compound Name | CID 177209576 |
| PubChem CID | 177209576 |
| Molecular Formula | C24H2B13NO |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c([nH]c3c([B])c([B])c(-c4cc([B])c5oc6c([B])c([B])c([B])c([B])c6c5c4[B])c([B])c32)c1[B] |
| InChI | InChI=1S/C24H2B13NO/c25-3-1-2(9(26)7-8-13(30)15(32)17(34)20(37)24(8)39-23(3)7)4-10(27)5-6-12(29)14(31)16(33)19(36)22(6)38-21(5)18(35)11(4)28/h1,38H |
| InChIKey | XROZBPIUAZECHO-UHFFFAOYSA-N |
| XLogP | -8.79 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | -8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177209576 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177209576?
The IUPAC name of CID 177209576 (CID 177209576) is not available.
What is the SMILES notation for CID 177209576?
The canonical SMILES for CID 177209576 is [B]c1c([B])c([B])c2c([nH]c3c([B])c([B])c(-c4cc([B])c5oc6c([B])c([B])c([B])c([B])c6c5c4[B])c([B])c32)c1[B].
What is the InChIKey of CID 177209576?
The InChIKey is XROZBPIUAZECHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H2B13NO/c25-3-1-2(9(26)7-8-13(30)15(32)17(34)20(37)24(8)39-23(3)7)4-10(27)5-6-12(29)14(31)16(33)19(36)22(6)38-21(5)18(35)11(4)28/h1,38H.
What are the key properties of CID 177209576?
CID 177209576 has a molecular weight of 460.84 g/mol, XLogP of -8.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177209576 is sourced from PubChem (CID 177209576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).