C19H13CuF7N2O2 — CID 177209914
copper;(2E)-2-ethenyl-1-[5-hydroxy-3-methyl-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]-4-methylpenta-2,4-dien-1-one (PubChem CID 177209914) has the molecular formula C19H13CuF7N2O2 and a molecular weight of 497.86 g/mol. Its IUPAC name is copper;(2E)-2-ethenyl-1-[5-hydroxy-3-methyl-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]-4-methylpenta-2,4-dien-1-one.
| Compound Name | copper;(2E)-2-ethenyl-1-[5-hydroxy-3-methyl-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]-4-methylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 177209914 |
| Molecular Formula | C19H13CuF7N2O2 |
| Molecular Weight | 497.86 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | copper;(2E)-2-ethenyl-1-[5-hydroxy-3-methyl-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazol-4-yl]-4-methylpenta-2,4-dien-1-one |
| SMILES | C=C/C(=C\C(=C)C)C(=O)c1c(C)nn(-c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1O.[Cu] |
| InChI | InChI=1S/C19H13F7N2O2.Cu/c1-5-9(6-7(2)3)17(29)10-8(4)27-28(18(10)30)16-14(22)12(20)11(19(24,25)26)13(21)15(16)23;/h5-6,30H,1-2H2,3-4H3;/b9-6+; |
| InChIKey | ALGKNZVVGMGQJY-MLBSPLJJSA-N |
| XLogP | 5.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|