C19H7CuF11N2O2 — CID 177209962
[3,5-bis(trifluoromethyl)phenyl]-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]methanone;copper (PubChem CID 177209962) has the molecular formula C19H7CuF11N2O2 and a molecular weight of 567.80 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]methanone;copper.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]methanone;copper |
|---|---|
| PubChem CID | 177209962 |
| Molecular Formula | C19H7CuF11N2O2 |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 566.96 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[5-hydroxy-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-yl]methanone;copper |
| SMILES | Cc1nn(-c2c(F)c(F)c(F)c(F)c2F)c(O)c1C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Cu] |
| InChI | InChI=1S/C19H7F11N2O2.Cu/c1-5-9(16(33)6-2-7(18(25,26)27)4-8(3-6)19(28,29)30)17(34)32(31-5)15-13(23)11(21)10(20)12(22)14(15)24;/h2-4,34H,1H3; |
| InChIKey | OHJOGLXIQFTIGF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|