C18H15F6N3O3 — CID 177209984
4-[2-hydroxy-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)ethyl]-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)-5,6-dihydro-4H-1,3-oxazin-6-ol (PubChem CID 177209984) has the molecular formula C18H15F6N3O3 and a molecular weight of 435.32 g/mol. Its IUPAC name is 4-[2-hydroxy-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)ethyl]-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)-5,6-dihydro-4H-1,3-oxazin-6-ol.
| Compound Name | 4-[2-hydroxy-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)ethyl]-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)-5,6-dihydro-4H-1,3-oxazin-6-ol |
|---|---|
| PubChem CID | 177209984 |
| Molecular Formula | C18H15F6N3O3 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-[2-hydroxy-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)ethyl]-2-(2,3,5-trifluoro-6-methyl-4-pyridinyl)-5,6-dihydro-4H-1,3-oxazin-6-ol |
| SMILES | Cc1nc(F)c(F)c(C2=NC(CC(O)c3c(F)c(C)nc(F)c3F)CC(O)O2)c1F |
| InChI | InChI=1S/C18H15F6N3O3/c1-5-12(19)10(14(21)16(23)25-5)8(28)3-7-4-9(29)30-18(27-7)11-13(20)6(2)26-17(24)15(11)22/h7-9,28-29H,3-4H2,1-2H3 |
| InChIKey | KXNTWCNHUBTAPW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|