About 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol
2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol (PubChem CID 177210075) has the molecular formula C13H11F3O4
and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol.
Molecular Properties
| Compound Name | 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol |
| PubChem CID | 177210075 |
| Molecular Formula | C13H11F3O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol |
| SMILES | CO.O=C(CC1C(=O)c2ccc(F)cc2C1=O)C(F)F |
| InChI | InChI=1S/C12H7F3O3.CH4O/c13-5-1-2-6-7(3-5)11(18)8(10(6)17)4-9(16)12(14)15;1-2/h1-3,8,12H,4H2;2H,1H3 |
| InChIKey | RKMIWESTYCGTSE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol?
The IUPAC name of 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol (CID 177210075) is 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol.
What is the SMILES notation for 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol?
The canonical SMILES for 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol is CO.O=C(CC1C(=O)c2ccc(F)cc2C1=O)C(F)F.
What is the InChIKey of 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol?
The InChIKey is RKMIWESTYCGTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3O3.CH4O/c13-5-1-2-6-7(3-5)11(18)8(10(6)17)4-9(16)12(14)15;1-2/h1-3,8,12H,4H2;2H,1H3.
What are the key properties of 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol?
2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol has a molecular weight of 288.22 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoro-2-oxopropyl)-5-fluoroindene-1,3-dione;methanol is sourced from PubChem (CID 177210075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).