C21H25F3O4 — CID 177210100
ethane;3-hydroxy-2-[hydroxy-(2,3,6-trifluoro-4,5-dimethylphenyl)methyl]-3,6-dihydro-2H-azulen-1-one;hydrate (PubChem CID 177210100) has the molecular formula C21H25F3O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethane;3-hydroxy-2-[hydroxy-(2,3,6-trifluoro-4,5-dimethylphenyl)methyl]-3,6-dihydro-2H-azulen-1-one;hydrate.
| Compound Name | ethane;3-hydroxy-2-[hydroxy-(2,3,6-trifluoro-4,5-dimethylphenyl)methyl]-3,6-dihydro-2H-azulen-1-one;hydrate |
|---|---|
| PubChem CID | 177210100 |
| Molecular Formula | C21H25F3O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethane;3-hydroxy-2-[hydroxy-(2,3,6-trifluoro-4,5-dimethylphenyl)methyl]-3,6-dihydro-2H-azulen-1-one;hydrate |
| SMILES | CC.Cc1c(C)c(F)c(C(O)C2C(=O)C3=C(C=CCC=C3)C2O)c(F)c1F.O |
| InChI | InChI=1S/C19H17F3O3.C2H6.H2O/c1-8-9(2)15(21)16(22)12(14(8)20)19(25)13-17(23)10-6-4-3-5-7-11(10)18(13)24;1-2;/h4-7,13,17,19,23,25H,3H2,1-2H3;1-2H3;1H2 |
| InChIKey | MDMLYLRDGVZOLM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|