C13H17F3O2 — CID 177210153
ethene;1-ethenyl-3-hydroperoxy-2-methyl-5-methylidene-4-(2,2,2-trifluoroethyl)cyclopentene (PubChem CID 177210153) has the molecular formula C13H17F3O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is ethene;1-ethenyl-3-hydroperoxy-2-methyl-5-methylidene-4-(2,2,2-trifluoroethyl)cyclopentene.
| Compound Name | ethene;1-ethenyl-3-hydroperoxy-2-methyl-5-methylidene-4-(2,2,2-trifluoroethyl)cyclopentene |
|---|---|
| PubChem CID | 177210153 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethene;1-ethenyl-3-hydroperoxy-2-methyl-5-methylidene-4-(2,2,2-trifluoroethyl)cyclopentene |
| SMILES | C=C.C=CC1=C(C)C(OO)C(CC(F)(F)F)C1=C |
| InChI | InChI=1S/C11H13F3O2.C2H4/c1-4-8-6(2)9(5-11(12,13)14)10(16-15)7(8)3;1-2/h4,9-10,15H,1-2,5H2,3H3;1-2H2 |
| InChIKey | OWMDAXAIWMVZOA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|