C13H10F7NO3 — CID 177210174
4-(3,3-difluoro-2-hydroxypropyl)-2-(2,3,4,5,6-pentafluorophenyl)-5,6-dihydro-4H-1,3-oxazin-6-ol (PubChem CID 177210174) has the molecular formula C13H10F7NO3 and a molecular weight of 361.21 g/mol. Its IUPAC name is 4-(3,3-difluoro-2-hydroxypropyl)-2-(2,3,4,5,6-pentafluorophenyl)-5,6-dihydro-4H-1,3-oxazin-6-ol.
| Compound Name | 4-(3,3-difluoro-2-hydroxypropyl)-2-(2,3,4,5,6-pentafluorophenyl)-5,6-dihydro-4H-1,3-oxazin-6-ol |
|---|---|
| PubChem CID | 177210174 |
| Molecular Formula | C13H10F7NO3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 4-(3,3-difluoro-2-hydroxypropyl)-2-(2,3,4,5,6-pentafluorophenyl)-5,6-dihydro-4H-1,3-oxazin-6-ol |
| SMILES | OC1CC(CC(O)C(F)F)N=C(c2c(F)c(F)c(F)c(F)c2F)O1 |
| InChI | InChI=1S/C13H10F7NO3/c14-7-6(8(15)10(17)11(18)9(7)16)13-21-3(2-5(23)24-13)1-4(22)12(19)20/h3-5,12,22-23H,1-2H2 |
| InChIKey | YPWNWSLJRFXWPP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|