About 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol
2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol (PubChem CID 177210202) has the molecular formula C11H12FNO3
and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol |
| PubChem CID | 177210202 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol |
| SMILES | CC(O)C1N=C(c2ccc(F)cc2)OC1O |
| InChI | InChI=1S/C11H12FNO3/c1-6(14)9-11(15)16-10(13-9)7-2-4-8(12)5-3-7/h2-6,9,11,14-15H,1H3 |
| InChIKey | KYUFRRAKHNWGCB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol?
The IUPAC name of 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol (CID 177210202) is 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol.
What is the SMILES notation for 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol?
The canonical SMILES for 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol is CC(O)C1N=C(c2ccc(F)cc2)OC1O.
What is the InChIKey of 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol?
The InChIKey is KYUFRRAKHNWGCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO3/c1-6(14)9-11(15)16-10(13-9)7-2-4-8(12)5-3-7/h2-6,9,11,14-15H,1H3.
What are the key properties of 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol?
2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol has a molecular weight of 225.22 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4-(1-hydroxyethyl)-4,5-dihydro-1,3-oxazol-5-ol is sourced from PubChem (CID 177210202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).