About CID 177210775
CID 177210775 (PubChem CID 177210775) has the molecular formula C40H47BClF4N6O2
and a molecular weight of 766.11 g/mol.
Molecular Properties
| Compound Name | CID 177210775 |
| PubChem CID | 177210775 |
| Molecular Formula | C40H47BClF4N6O2 |
| Molecular Weight | 766.11 g/mol |
| Exact Mass | 765.35 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\[B]NC)c1c(Cl)ccc(-n2c(C(Cc3cc(F)cc(F)c3)C(C)C)nc3nc(C4CCC(F)(F)CC4)cc(CN4CC(C)OC(C)C4)c3c2=O)c1C |
| InChI | InChI=1S/C40H47BClF4N6O2/c1-21(2)30(15-25-13-28(43)17-29(44)14-25)38-50-37-35(39(53)52(38)33-8-7-31(42)34(24(33)5)36(47)41-48-6)27(20-51-18-22(3)54-23(4)19-51)16-32(49-37)26-9-11-40(45,46)12-10-26/h7-8,13-14,16-17,21-23,26,30,47-48H,9-12,15,18-20H2,1-6H3/b47-36- |
| InChIKey | LUNGOCKDNJWRQM-OBRSZTFSSA-N |
| XLogP | 8.07 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 766.11 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177210775 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177210775?
The IUPAC name of CID 177210775 (CID 177210775) is not available.
What is the SMILES notation for CID 177210775?
The canonical SMILES for CID 177210775 is [H]/N=C(\[B]NC)c1c(Cl)ccc(-n2c(C(Cc3cc(F)cc(F)c3)C(C)C)nc3nc(C4CCC(F)(F)CC4)cc(CN4CC(C)OC(C)C4)c3c2=O)c1C.
What is the InChIKey of CID 177210775?
The InChIKey is LUNGOCKDNJWRQM-OBRSZTFSSA-N. The full InChI is InChI=1S/C40H47BClF4N6O2/c1-21(2)30(15-25-13-28(43)17-29(44)14-25)38-50-37-35(39(53)52(38)33-8-7-31(42)34(24(33)5)36(47)41-48-6)27(20-51-18-22(3)54-23(4)19-51)16-32(49-37)26-9-11-40(45,46)12-10-26/h7-8,13-14,16-17,21-23,26,30,47-48H,9-12,15,18-20H2,1-6H3/b47-36-.
What are the key properties of CID 177210775?
CID 177210775 has a molecular weight of 766.11 g/mol, XLogP of 8.07, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177210775 is sourced from PubChem (CID 177210775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).