C40H47BClF4N6O2 — CID 177210775
CID 177210775 (PubChem CID 177210775) has the molecular formula C40H47BClF4N6O2 and a molecular weight of 766.11 g/mol.
| Compound Name | CID 177210775 |
|---|---|
| PubChem CID | 177210775 |
| Molecular Formula | C40H47BClF4N6O2 |
| Molecular Weight | 766.11 g/mol |
| Exact Mass | 765.35 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\[B]NC)c1c(Cl)ccc(-n2c(C(Cc3cc(F)cc(F)c3)C(C)C)nc3nc(C4CCC(F)(F)CC4)cc(CN4CC(C)OC(C)C4)c3c2=O)c1C |
| InChI | InChI=1S/C40H47BClF4N6O2/c1-21(2)30(15-25-13-28(43)17-29(44)14-25)38-50-37-35(39(53)52(38)33-8-7-31(42)34(24(33)5)36(47)41-48-6)27(20-51-18-22(3)54-23(4)19-51)16-32(49-37)26-9-11-40(45,46)12-10-26/h7-8,13-14,16-17,21-23,26,30,47-48H,9-12,15,18-20H2,1-6H3/b47-36- |
| InChIKey | LUNGOCKDNJWRQM-OBRSZTFSSA-N |
| XLogP | 8.07 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.11 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|