C29H34N6O2 — CID 177212717
8-methyl-N-[[(3R)-5-methyl-5-azaspiro[2.4]heptan-2-yl]methoxymethyl]-5-[2-(5-morpholin-4-yl-2-pyridinyl)ethynyl]-2,7-naphthyridin-3-amine (PubChem CID 177212717) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 8-methyl-N-[[(3R)-5-methyl-5-azaspiro[2.4]heptan-2-yl]methoxymethyl]-5-[2-(5-morpholin-4-yl-2-pyridinyl)ethynyl]-2,7-naphthyridin-3-amine.
| Compound Name | 8-methyl-N-[[(3R)-5-methyl-5-azaspiro[2.4]heptan-2-yl]methoxymethyl]-5-[2-(5-morpholin-4-yl-2-pyridinyl)ethynyl]-2,7-naphthyridin-3-amine |
|---|---|
| PubChem CID | 177212717 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 8-methyl-N-[[(3R)-5-methyl-5-azaspiro[2.4]heptan-2-yl]methoxymethyl]-5-[2-(5-morpholin-4-yl-2-pyridinyl)ethynyl]-2,7-naphthyridin-3-amine |
| SMILES | Cc1ncc(C#Cc2ccc(N3CCOCC3)cn2)c2cc(NCOCC3C[C@@]34CCN(C)C4)ncc12 |
| InChI | InChI=1S/C29H34N6O2/c1-21-27-17-32-28(33-20-37-18-23-14-29(23)7-8-34(2)19-29)13-26(27)22(15-30-21)3-4-24-5-6-25(16-31-24)35-9-11-36-12-10-35/h5-6,13,15-17,23H,7-12,14,18-20H2,1-2H3,(H,32,33)/t23?,29-/m1/s1 |
| InChIKey | UXRWYIDOOWMRIV-GJQLDDCUSA-N |
| XLogP | 3.30 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|