C23H23N3O2 — CID 177212726
3-[6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-3-pyridinyl]-6-methyloxan-3-ol (PubChem CID 177212726) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-3-pyridinyl]-6-methyloxan-3-ol.
| Compound Name | 3-[6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-3-pyridinyl]-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 177212726 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-[6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-3-pyridinyl]-6-methyloxan-3-ol |
| SMILES | Cc1cc2c(C#Cc3ccc(C4(O)CCC(C)OC4)cn3)cnc(C)c2cn1 |
| InChI | InChI=1S/C23H23N3O2/c1-15-10-21-18(11-25-17(3)22(21)13-24-15)4-6-20-7-5-19(12-26-20)23(27)9-8-16(2)28-14-23/h5,7,10-13,16,27H,8-9,14H2,1-3H3 |
| InChIKey | OTYHYMKPXLNYIU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|