About 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol
6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol (PubChem CID 177212780) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol.
Molecular Properties
| Compound Name | 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol |
| PubChem CID | 177212780 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol |
| SMILES | Cc1cc2c(C#Cc3cc(C4CCOCC4)c(O)cn3)cnc(C)c2cn1 |
| InChI | InChI=1S/C22H21N3O2/c1-14-9-19-17(11-24-15(2)21(19)12-23-14)3-4-18-10-20(22(26)13-25-18)16-5-7-27-8-6-16/h9-13,16,26H,5-8H2,1-2H3 |
| InChIKey | SIWHQICREFKRMI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol?
The IUPAC name of 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol (CID 177212780) is 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol.
What is the SMILES notation for 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol?
The canonical SMILES for 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol is Cc1cc2c(C#Cc3cc(C4CCOCC4)c(O)cn3)cnc(C)c2cn1.
What is the InChIKey of 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol?
The InChIKey is SIWHQICREFKRMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-14-9-19-17(11-24-15(2)21(19)12-23-14)3-4-18-10-20(22(26)13-25-18)16-5-7-27-8-6-16/h9-13,16,26H,5-8H2,1-2H3.
What are the key properties of 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol?
6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol has a molecular weight of 359.43 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(1,6-dimethyl-2,7-naphthyridin-4-yl)ethynyl]-4-(oxan-4-yl)pyridin-3-ol is sourced from PubChem (CID 177212780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).