About 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine
1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine (PubChem CID 177212817) has the molecular formula C22H21N3O
and a molecular weight of 343.43 g/mol. Its IUPAC name is 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine |
| PubChem CID | 177212817 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine |
| SMILES | Cc1cc2c(C#Cc3ccc(C4CCCOC4)cn3)cnc(C)c2cn1 |
| InChI | InChI=1S/C22H21N3O/c1-15-10-21-18(12-24-16(2)22(21)13-23-15)6-8-20-7-5-17(11-25-20)19-4-3-9-26-14-19/h5,7,10-13,19H,3-4,9,14H2,1-2H3 |
| InChIKey | MIUXENDYZQKZPQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine?
The IUPAC name of 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine (CID 177212817) is 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine.
What is the SMILES notation for 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine?
The canonical SMILES for 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine is Cc1cc2c(C#Cc3ccc(C4CCCOC4)cn3)cnc(C)c2cn1.
What is the InChIKey of 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine?
The InChIKey is MIUXENDYZQKZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O/c1-15-10-21-18(12-24-16(2)22(21)13-23-15)6-8-20-7-5-17(11-25-20)19-4-3-9-26-14-19/h5,7,10-13,19H,3-4,9,14H2,1-2H3.
What are the key properties of 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine?
1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine has a molecular weight of 343.43 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-[2-[5-(oxan-3-yl)-2-pyridinyl]ethynyl]-2,7-naphthyridine is sourced from PubChem (CID 177212817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).