C20H16N4O2 — CID 177212890
N-[5-[2-(5-hydroxy-2-pyridinyl)ethynyl]-8-methyl-2,7-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 177212890) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[5-[2-(5-hydroxy-2-pyridinyl)ethynyl]-8-methyl-2,7-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[2-(5-hydroxy-2-pyridinyl)ethynyl]-8-methyl-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 177212890 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[5-[2-(5-hydroxy-2-pyridinyl)ethynyl]-8-methyl-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | Cc1ncc(C#Cc2ccc(O)cn2)c2cc(NC(=O)C3CC3)ncc12 |
| InChI | InChI=1S/C20H16N4O2/c1-12-18-11-23-19(24-20(26)13-2-3-13)8-17(18)14(9-21-12)4-5-15-6-7-16(25)10-22-15/h6-11,13,25H,2-3H2,1H3,(H,23,24,26) |
| InChIKey | ZWDZZFLXHYGAAR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|