C11H16N2 — CID 177213177
2,3,4,5-tetramethyl-N-(methylideneamino)aniline (PubChem CID 177213177) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-N-(methylideneamino)aniline.
| Compound Name | 2,3,4,5-tetramethyl-N-(methylideneamino)aniline |
|---|---|
| PubChem CID | 177213177 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3,4,5-tetramethyl-N-(methylideneamino)aniline |
| SMILES | C=NNc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C11H16N2/c1-7-6-11(13-12-5)10(4)9(3)8(7)2/h6,13H,5H2,1-4H3 |
| InChIKey | BAAJFXLIMFMYSD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|