About 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone
2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone (PubChem CID 177213923) has the molecular formula C10H10BrF2NO2
and a molecular weight of 294.10 g/mol. Its IUPAC name is 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone |
| PubChem CID | 177213923 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone |
| SMILES | O=C(CBr)c1cccnc1COCC(F)F |
| InChI | InChI=1S/C10H10BrF2NO2/c11-4-9(15)7-2-1-3-14-8(7)5-16-6-10(12)13/h1-3,10H,4-6H2 |
| InChIKey | SPERQKQJHWTZFF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone?
The IUPAC name of 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone (CID 177213923) is 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone.
What is the SMILES notation for 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone?
The canonical SMILES for 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone is O=C(CBr)c1cccnc1COCC(F)F.
What is the InChIKey of 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone?
The InChIKey is SPERQKQJHWTZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrF2NO2/c11-4-9(15)7-2-1-3-14-8(7)5-16-6-10(12)13/h1-3,10H,4-6H2.
What are the key properties of 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone?
2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone has a molecular weight of 294.10 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[2-(2,2-difluoroethoxymethyl)-3-pyridinyl]ethanone is sourced from PubChem (CID 177213923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).