C10H7ClF3N3O2 — CID 177214383
5-chloro-1,3-dimethyl-7-(trifluoromethyl)pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 177214383) has the molecular formula C10H7ClF3N3O2 and a molecular weight of 293.63 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-7-(trifluoromethyl)pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1,3-dimethyl-7-(trifluoromethyl)pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177214383 |
| Molecular Formula | C10H7ClF3N3O2 |
| Molecular Weight | 293.63 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 5-chloro-1,3-dimethyl-7-(trifluoromethyl)pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(Cl)nc(C(F)(F)F)cc2n(C)c1=O |
| InChI | InChI=1S/C10H7ClF3N3O2/c1-16-4-3-5(10(12,13)14)15-7(11)6(4)8(18)17(2)9(16)19/h3H,1-2H3 |
| InChIKey | DTBFDKDRSDYEKC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.63 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|