C15H28N4 — CID 177216892
(2Z)-N'-ethenyl-2-ethylidenepentanimidamide;(1Z,3Z)-hexa-1,3-diene-1,4-diamine (PubChem CID 177216892) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is (2Z)-N'-ethenyl-2-ethylidenepentanimidamide;(1Z,3Z)-hexa-1,3-diene-1,4-diamine.
| Compound Name | (2Z)-N'-ethenyl-2-ethylidenepentanimidamide;(1Z,3Z)-hexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 177216892 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (2Z)-N'-ethenyl-2-ethylidenepentanimidamide;(1Z,3Z)-hexa-1,3-diene-1,4-diamine |
| SMILES | C=C/N=C(N)/C(=C\C)CCC.CC/C(N)=C/C=C\N |
| InChI | InChI=1S/C9H16N2.C6H12N2/c1-4-7-8(5-2)9(10)11-6-3;1-2-6(8)4-3-5-7/h5-6H,3-4,7H2,1-2H3,(H2,10,11);3-5H,2,7-8H2,1H3/b8-5-;5-3-,6-4- |
| InChIKey | NWPVEHOBYFULBG-PQIHCTGOSA-N |
| XLogP | 2.94 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|